C11H12ClF3O2 — CID 83953043
1-(3-chloro-4-propan-2-yloxyphenyl)-2,2,2-trifluoroethanol (PubChem CID 83953043) has the molecular formula C11H12ClF3O2 and a molecular weight of 268.66 g/mol. Its IUPAC name is 1-(3-chloro-4-propan-2-yloxyphenyl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(3-chloro-4-propan-2-yloxyphenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 83953043 |
| Molecular Formula | C11H12ClF3O2 |
| Molecular Weight | 268.66 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-(3-chloro-4-propan-2-yloxyphenyl)-2,2,2-trifluoroethanol |
| SMILES | CC(C)Oc1ccc(C(O)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H12ClF3O2/c1-6(2)17-9-4-3-7(5-8(9)12)10(16)11(13,14)15/h3-6,10,16H,1-2H3 |
| InChIKey | LSOMUWHMEZDEEW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.66 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |