C16H15Cl2N3O — CID 83953103
2-(3,5-dichloro-4-propoxyphenyl)-3H-benzimidazol-5-amine (PubChem CID 83953103) has the molecular formula C16H15Cl2N3O and a molecular weight of 336.22 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-propoxyphenyl)-3H-benzimidazol-5-amine.
| Compound Name | 2-(3,5-dichloro-4-propoxyphenyl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 83953103 |
| Molecular Formula | C16H15Cl2N3O |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-(3,5-dichloro-4-propoxyphenyl)-3H-benzimidazol-5-amine |
| SMILES | CCCOc1c(Cl)cc(-c2nc3ccc(N)cc3[nH]2)cc1Cl |
| InChI | InChI=1S/C16H15Cl2N3O/c1-2-5-22-15-11(17)6-9(7-12(15)18)16-20-13-4-3-10(19)8-14(13)21-16/h3-4,6-8H,2,5,19H2,1H3,(H,20,21) |
| InChIKey | TWTAVFNVBGHCIO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|