C12H13Cl2F3O3 — CID 83953596
1-(3,5-dichloro-2,4-diethoxyphenyl)-2,2,2-trifluoroethanol (PubChem CID 83953596) has the molecular formula C12H13Cl2F3O3 and a molecular weight of 333.13 g/mol. Its IUPAC name is 1-(3,5-dichloro-2,4-diethoxyphenyl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(3,5-dichloro-2,4-diethoxyphenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 83953596 |
| Molecular Formula | C12H13Cl2F3O3 |
| Molecular Weight | 333.13 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 1-(3,5-dichloro-2,4-diethoxyphenyl)-2,2,2-trifluoroethanol |
| SMILES | CCOc1c(Cl)cc(C(O)C(F)(F)F)c(OCC)c1Cl |
| InChI | InChI=1S/C12H13Cl2F3O3/c1-3-19-9-6(11(18)12(15,16)17)5-7(13)10(8(9)14)20-4-2/h5,11,18H,3-4H2,1-2H3 |
| InChIKey | YMRLIGWWIWTNBV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.13 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |