C17H30N4 — CID 83955073
N'-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]butane-1,4-diamine (PubChem CID 83955073) has the molecular formula C17H30N4 and a molecular weight of 290.46 g/mol. Its IUPAC name is N'-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]butane-1,4-diamine.
| Compound Name | N'-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 83955073 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | N'-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]butane-1,4-diamine |
| SMILES | CC(C)N1CCN(c2ccc(NCCCCN)cc2)CC1 |
| InChI | InChI=1S/C17H30N4/c1-15(2)20-11-13-21(14-12-20)17-7-5-16(6-8-17)19-10-4-3-9-18/h5-8,15,19H,3-4,9-14,18H2,1-2H3 |
| InChIKey | CLKLCFVGIGCINJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|