About (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine
(2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine (PubChem CID 83956637) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine.
Molecular Properties
| Compound Name | (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine |
| PubChem CID | 83956637 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine |
| SMILES | CCN1Cc2ccc(CN)cc2CC1C |
| InChI | InChI=1S/C13H20N2/c1-3-15-9-12-5-4-11(8-14)7-13(12)6-10(15)2/h4-5,7,10H,3,6,8-9,14H2,1-2H3 |
| InChIKey | VFMFPNPXGHMZSR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine?
The IUPAC name of (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine (CID 83956637) is (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine.
What is the SMILES notation for (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine?
The canonical SMILES for (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine is CCN1Cc2ccc(CN)cc2CC1C.
What is the InChIKey of (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine?
The InChIKey is VFMFPNPXGHMZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-3-15-9-12-5-4-11(8-14)7-13(12)6-10(15)2/h4-5,7,10H,3,6,8-9,14H2,1-2H3.
What are the key properties of (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine?
(2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine has a molecular weight of 204.32 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl)methanamine is sourced from PubChem (CID 83956637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).