C17H25F3N2 — CID 83956704
N-[[3-ethyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-yl]methyl]propan-1-amine (PubChem CID 83956704) has the molecular formula C17H25F3N2 and a molecular weight of 314.40 g/mol. Its IUPAC name is N-[[3-ethyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-ethyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 83956704 |
| Molecular Formula | C17H25F3N2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-[[3-ethyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc2c(c1)CC(CC)N(CC(F)(F)F)C2 |
| InChI | InChI=1S/C17H25F3N2/c1-3-7-21-10-13-5-6-14-11-22(12-17(18,19)20)16(4-2)9-15(14)8-13/h5-6,8,16,21H,3-4,7,9-12H2,1-2H3 |
| InChIKey | LIWKCQMJULDSEB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|