C10H10F6N2O2 — CID 83957756
3-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]butanoic acid (PubChem CID 83957756) has the molecular formula C10H10F6N2O2 and a molecular weight of 304.19 g/mol. Its IUPAC name is 3-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]butanoic acid.
| Compound Name | 3-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 83957756 |
| Molecular Formula | C10H10F6N2O2 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]butanoic acid |
| SMILES | CC(CC(=O)O)c1c(C(F)(F)F)nn(C)c1C(F)(F)F |
| InChI | InChI=1S/C10H10F6N2O2/c1-4(3-5(19)20)6-7(9(11,12)13)17-18(2)8(6)10(14,15)16/h4H,3H2,1-2H3,(H,19,20) |
| InChIKey | KBGZIWGJMMWTRO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |