C11H12F6N2O2 — CID 83957757
3-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentanoic acid (PubChem CID 83957757) has the molecular formula C11H12F6N2O2 and a molecular weight of 318.22 g/mol. Its IUPAC name is 3-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentanoic acid.
| Compound Name | 3-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 83957757 |
| Molecular Formula | C11H12F6N2O2 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]pentanoic acid |
| SMILES | CCC(CC(=O)O)c1c(C(F)(F)F)nn(C)c1C(F)(F)F |
| InChI | InChI=1S/C11H12F6N2O2/c1-3-5(4-6(20)21)7-8(10(12,13)14)18-19(2)9(7)11(15,16)17/h5H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | UKNYSDPVMFKALJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |