C12H14F6N2O2 — CID 83957759
3-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]hexanoic acid (PubChem CID 83957759) has the molecular formula C12H14F6N2O2 and a molecular weight of 332.24 g/mol. Its IUPAC name is 3-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]hexanoic acid.
| Compound Name | 3-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]hexanoic acid |
|---|---|
| PubChem CID | 83957759 |
| Molecular Formula | C12H14F6N2O2 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 3-[1-methyl-3,5-bis(trifluoromethyl)pyrazol-4-yl]hexanoic acid |
| SMILES | CCCC(CC(=O)O)c1c(C(F)(F)F)nn(C)c1C(F)(F)F |
| InChI | InChI=1S/C12H14F6N2O2/c1-3-4-6(5-7(21)22)8-9(11(13,14)15)19-20(2)10(8)12(16,17)18/h6H,3-5H2,1-2H3,(H,21,22) |
| InChIKey | FVSUUANCBCPMDN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |