About 2-(2-propyl-1,3-dioxolan-2-yl)phenol
2-(2-propyl-1,3-dioxolan-2-yl)phenol (PubChem CID 83957796) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(2-propyl-1,3-dioxolan-2-yl)phenol.
Molecular Properties
| Compound Name | 2-(2-propyl-1,3-dioxolan-2-yl)phenol |
| PubChem CID | 83957796 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-(2-propyl-1,3-dioxolan-2-yl)phenol |
| SMILES | CCCC1(c2ccccc2O)OCCO1 |
| InChI | InChI=1S/C12H16O3/c1-2-7-12(14-8-9-15-12)10-5-3-4-6-11(10)13/h3-6,13H,2,7-9H2,1H3 |
| InChIKey | RUIVTLASRNSLJT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-propyl-1,3-dioxolan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-propyl-1,3-dioxolan-2-yl)phenol?
The IUPAC name of 2-(2-propyl-1,3-dioxolan-2-yl)phenol (CID 83957796) is 2-(2-propyl-1,3-dioxolan-2-yl)phenol.
What is the SMILES notation for 2-(2-propyl-1,3-dioxolan-2-yl)phenol?
The canonical SMILES for 2-(2-propyl-1,3-dioxolan-2-yl)phenol is CCCC1(c2ccccc2O)OCCO1.
What is the InChIKey of 2-(2-propyl-1,3-dioxolan-2-yl)phenol?
The InChIKey is RUIVTLASRNSLJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-2-7-12(14-8-9-15-12)10-5-3-4-6-11(10)13/h3-6,13H,2,7-9H2,1H3.
What are the key properties of 2-(2-propyl-1,3-dioxolan-2-yl)phenol?
2-(2-propyl-1,3-dioxolan-2-yl)phenol has a molecular weight of 208.26 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-propyl-1,3-dioxolan-2-yl)phenol is sourced from PubChem (CID 83957796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).