C12H16O3 — CID 83957796
2-(2-propyl-1,3-dioxolan-2-yl)phenol (PubChem CID 83957796) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(2-propyl-1,3-dioxolan-2-yl)phenol.
| Compound Name | 2-(2-propyl-1,3-dioxolan-2-yl)phenol |
|---|---|
| PubChem CID | 83957796 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-(2-propyl-1,3-dioxolan-2-yl)phenol |
| SMILES | CCCC1(c2ccccc2O)OCCO1 |
| InChI | InChI=1S/C12H16O3/c1-2-7-12(14-8-9-15-12)10-5-3-4-6-11(10)13/h3-6,13H,2,7-9H2,1H3 |
| InChIKey | RUIVTLASRNSLJT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |