C20H30O3 — CID 83958249
(E)-3-[3-tert-butyl-4-(2-methylpropoxy)phenyl]hex-2-enoic acid (PubChem CID 83958249) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (E)-3-[3-tert-butyl-4-(2-methylpropoxy)phenyl]hex-2-enoic acid.
| Compound Name | (E)-3-[3-tert-butyl-4-(2-methylpropoxy)phenyl]hex-2-enoic acid |
|---|---|
| PubChem CID | 83958249 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (E)-3-[3-tert-butyl-4-(2-methylpropoxy)phenyl]hex-2-enoic acid |
| SMILES | CCC/C(=C\C(=O)O)c1ccc(OCC(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H30O3/c1-7-8-15(12-19(21)22)16-9-10-18(23-13-14(2)3)17(11-16)20(4,5)6/h9-12,14H,7-8,13H2,1-6H3,(H,21,22)/b15-12+ |
| InChIKey | IUKCMHZCDYABBW-NTCAYCPXSA-N |
| XLogP | 5.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|