About 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane
2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane (PubChem CID 83958252) has the molecular formula C20H32O3
and a molecular weight of 320.47 g/mol. Its IUPAC name is 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane |
| PubChem CID | 83958252 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane |
| SMILES | CCCC1(c2ccc(OCC(C)C)c(C(C)(C)C)c2)OCCO1 |
| InChI | InChI=1S/C20H32O3/c1-7-10-20(22-11-12-23-20)16-8-9-18(21-14-15(2)3)17(13-16)19(4,5)6/h8-9,13,15H,7,10-12,14H2,1-6H3 |
| InChIKey | ZZAXXSOZNISZMC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane?
The IUPAC name of 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane (CID 83958252) is 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane.
What is the SMILES notation for 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane?
The canonical SMILES for 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane is CCCC1(c2ccc(OCC(C)C)c(C(C)(C)C)c2)OCCO1.
What is the InChIKey of 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane?
The InChIKey is ZZAXXSOZNISZMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O3/c1-7-10-20(22-11-12-23-20)16-8-9-18(21-14-15(2)3)17(13-16)19(4,5)6/h8-9,13,15H,7,10-12,14H2,1-6H3.
What are the key properties of 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane?
2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane has a molecular weight of 320.47 g/mol, XLogP of 5.02, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-tert-butyl-4-(2-methylpropoxy)phenyl]-2-propyl-1,3-dioxolane is sourced from PubChem (CID 83958252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).