C15H20O2S — CID 83958405
(E)-4-(4-ethylsulfanylphenyl)hept-3-enoic acid (PubChem CID 83958405) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is (E)-4-(4-ethylsulfanylphenyl)hept-3-enoic acid.
| Compound Name | (E)-4-(4-ethylsulfanylphenyl)hept-3-enoic acid |
|---|---|
| PubChem CID | 83958405 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (E)-4-(4-ethylsulfanylphenyl)hept-3-enoic acid |
| SMILES | CCC/C(=C\CC(=O)O)c1ccc(SCC)cc1 |
| InChI | InChI=1S/C15H20O2S/c1-3-5-12(8-11-15(16)17)13-6-9-14(10-7-13)18-4-2/h6-10H,3-5,11H2,1-2H3,(H,16,17)/b12-8+ |
| InChIKey | SPFKRAHXBVGRPL-XYOKQWHBSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |