C18H27F3O2 — CID 83958752
1-(3,5-ditert-butyl-4-ethoxyphenyl)-2,2,2-trifluoroethanol (PubChem CID 83958752) has the molecular formula C18H27F3O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-ethoxyphenyl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(3,5-ditert-butyl-4-ethoxyphenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 83958752 |
| Molecular Formula | C18H27F3O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-ethoxyphenyl)-2,2,2-trifluoroethanol |
| SMILES | CCOc1c(C(C)(C)C)cc(C(O)C(F)(F)F)cc1C(C)(C)C |
| InChI | InChI=1S/C18H27F3O2/c1-8-23-14-12(16(2,3)4)9-11(15(22)18(19,20)21)10-13(14)17(5,6)7/h9-10,15,22H,8H2,1-7H3 |
| InChIKey | AEIULDQZRMKLMS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |