About 2-cyclohexylphenol
2-cyclohexylphenol (PubChem CID 8396) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-cyclohexylphenol.
Molecular Properties
| Compound Name | 2-cyclohexylphenol |
| PubChem CID | 8396 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-cyclohexylphenol |
| SMILES | Oc1ccccc1C1CCCCC1 |
| InChI | InChI=1S/C12H16O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4-5,8-10,13H,1-3,6-7H2 |
| InChIKey | MVRPPTGLVPEMPI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylphenol?
The IUPAC name of 2-cyclohexylphenol (CID 8396) is 2-cyclohexylphenol.
What is the SMILES notation for 2-cyclohexylphenol?
The canonical SMILES for 2-cyclohexylphenol is Oc1ccccc1C1CCCCC1.
What is the InChIKey of 2-cyclohexylphenol?
The InChIKey is MVRPPTGLVPEMPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4-5,8-10,13H,1-3,6-7H2.
What are the key properties of 2-cyclohexylphenol?
2-cyclohexylphenol has a molecular weight of 176.26 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylphenol is sourced from PubChem (CID 8396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).