C19H33N3 — CID 83960954
N'-[4-[(3-methylpiperidin-1-yl)methyl]phenyl]hexane-1,6-diamine (PubChem CID 83960954) has the molecular formula C19H33N3 and a molecular weight of 303.49 g/mol. Its IUPAC name is N'-[4-[(3-methylpiperidin-1-yl)methyl]phenyl]hexane-1,6-diamine.
| Compound Name | N'-[4-[(3-methylpiperidin-1-yl)methyl]phenyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 83960954 |
| Molecular Formula | C19H33N3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.27 |
| IUPAC Name | N'-[4-[(3-methylpiperidin-1-yl)methyl]phenyl]hexane-1,6-diamine |
| SMILES | CC1CCCN(Cc2ccc(NCCCCCCN)cc2)C1 |
| InChI | InChI=1S/C19H33N3/c1-17-7-6-14-22(15-17)16-18-8-10-19(11-9-18)21-13-5-3-2-4-12-20/h8-11,17,21H,2-7,12-16,20H2,1H3 |
| InChIKey | CRQYVCVHONFYHX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|