C20H27NO2 — CID 83961533
N-[(3-methylphenyl)methyl]-3,4-di(propan-2-yloxy)aniline (PubChem CID 83961533) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-3,4-di(propan-2-yloxy)aniline.
| Compound Name | N-[(3-methylphenyl)methyl]-3,4-di(propan-2-yloxy)aniline |
|---|---|
| PubChem CID | 83961533 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-3,4-di(propan-2-yloxy)aniline |
| SMILES | Cc1cccc(CNc2ccc(OC(C)C)c(OC(C)C)c2)c1 |
| InChI | InChI=1S/C20H27NO2/c1-14(2)22-19-10-9-18(12-20(19)23-15(3)4)21-13-17-8-6-7-16(5)11-17/h6-12,14-15,21H,13H2,1-5H3 |
| InChIKey | CLURCALHHMSVRJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|