C13H20N4 — CID 83961987
1-N-[2-(1-methylbenzimidazol-2-yl)ethyl]propane-1,2-diamine (PubChem CID 83961987) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-N-[2-(1-methylbenzimidazol-2-yl)ethyl]propane-1,2-diamine.
| Compound Name | 1-N-[2-(1-methylbenzimidazol-2-yl)ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 83961987 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 1-N-[2-(1-methylbenzimidazol-2-yl)ethyl]propane-1,2-diamine |
| SMILES | CC(N)CNCCc1nc2ccccc2n1C |
| InChI | InChI=1S/C13H20N4/c1-10(14)9-15-8-7-13-16-11-5-3-4-6-12(11)17(13)2/h3-6,10,15H,7-9,14H2,1-2H3 |
| InChIKey | JROLTFDVHKIEAW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|