C10H15NO — CID 83963277
cyclopentyl(3,4-dihydro-2H-pyrrol-5-yl)methanone (PubChem CID 83963277) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is cyclopentyl(3,4-dihydro-2H-pyrrol-5-yl)methanone.
| Compound Name | cyclopentyl(3,4-dihydro-2H-pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 83963277 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | cyclopentyl(3,4-dihydro-2H-pyrrol-5-yl)methanone |
| SMILES | O=C(C1=NCCC1)C1CCCC1 |
| InChI | InChI=1S/C10H15NO/c12-10(8-4-1-2-5-8)9-6-3-7-11-9/h8H,1-7H2 |
| InChIKey | ZVPTUPIZHOACGK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |