1,3-diethyl-6-methylindole-5-carboxylic acid

C14H17NO2 — CID 83963376

IUPAC1,3-diethyl-6-methylindole-5-carboxylic acid
SMILESCCc1cn(CC)c2cc(C)c(C(=O)O)cc12
InChIInChI=1S/C14H17NO2/c1-4-10-8-15(5-2)13-6-9(3)11(14(16)17)7-12(10)13/h6-8H,4-5H2,1-3H3,(H,16,17)
InChIKeyFGKGTUGCZJAQPP-UHFFFAOYSA-N
MW231.29 g/mol
LogP3.23
Rot. Bonds3

About 1,3-diethyl-6-methylindole-5-carboxylic acid

1,3-diethyl-6-methylindole-5-carboxylic acid (PubChem CID 83963376) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 1,3-diethyl-6-methylindole-5-carboxylic acid.

Molecular Properties

Compound Name1,3-diethyl-6-methylindole-5-carboxylic acid
PubChem CID83963376
Molecular FormulaC14H17NO2
Molecular Weight231.29 g/mol
Exact Mass231.13
IUPAC Name1,3-diethyl-6-methylindole-5-carboxylic acid
SMILESCCc1cn(CC)c2cc(C)c(C(=O)O)cc12
InChIInChI=1S/C14H17NO2/c1-4-10-8-15(5-2)13-6-9(3)11(14(16)17)7-12(10)13/h6-8H,4-5H2,1-3H3,(H,16,17)
InChIKeyFGKGTUGCZJAQPP-UHFFFAOYSA-N
XLogP3.23
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.29
LogP ≤ 53.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1,3-diethyl-6-methylindole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-butyl-1-(2-hydroxyethyl)-6-methylindole-5-carboxylic acid
CID 83963392
1,6-dimethyl-3-propylindole-5-carboxylic acid
CID 83963400
1,3-diethyl-5-methylindole-7-carboxylic acid
CID 83946021
3-(3-aminopropyl)-1-(2-hydroxyethyl)-6-methylindole-5-carboxylic acid
CID 83963394
1-(2-hydroxyethyl)-6-methyl-3-(2-pyrrolidin-1-ylethyl)indole-5-carboxylic acid
CID 83946955
1-ethyl-5-methylindole-3-carboxylic acid
CID 52911028
1-(3-hydroxypropyl)-6-methyl-3-(2-pyrrolidin-1-ylethyl)indole-5-carboxylic acid
CID 83946979
1,3,5-triethylindole-7-carboxylic acid
CID 83946119
1-(2-hydroxyethyl)-5,6-dimethylindole-3-carboxylic acid
CID 83947394
6-ethyl-2,3-dihydro-[1,4]dioxino[2,3-f]indole-8-carboxylic acid
CID 83947489
ethane;5-ethyl-2,4-dimethylbenzoic acid
CID 142198563
1-butyl-5-methyl-3-(2-pyrrolidin-1-ylethyl)indole-6-carboxylic acid
CID 83947013

Frequently Asked Questions

What is the IUPAC name of 1,3-diethyl-6-methylindole-5-carboxylic acid?
The IUPAC name of 1,3-diethyl-6-methylindole-5-carboxylic acid (CID 83963376) is 1,3-diethyl-6-methylindole-5-carboxylic acid.
What is the SMILES notation for 1,3-diethyl-6-methylindole-5-carboxylic acid?
The canonical SMILES for 1,3-diethyl-6-methylindole-5-carboxylic acid is CCc1cn(CC)c2cc(C)c(C(=O)O)cc12.
What is the InChIKey of 1,3-diethyl-6-methylindole-5-carboxylic acid?
The InChIKey is FGKGTUGCZJAQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2/c1-4-10-8-15(5-2)13-6-9(3)11(14(16)17)7-12(10)13/h6-8H,4-5H2,1-3H3,(H,16,17).
What are the key properties of 1,3-diethyl-6-methylindole-5-carboxylic acid?
1,3-diethyl-6-methylindole-5-carboxylic acid has a molecular weight of 231.29 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-6-methylindole-5-carboxylic acid is sourced from PubChem (CID 83963376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).