C18H25NO3 — CID 83963944
3-butyl-1-(3-hydroxypropyl)-2,5-dimethylindole-6-carboxylic acid (PubChem CID 83963944) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 3-butyl-1-(3-hydroxypropyl)-2,5-dimethylindole-6-carboxylic acid.
| Compound Name | 3-butyl-1-(3-hydroxypropyl)-2,5-dimethylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 83963944 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 3-butyl-1-(3-hydroxypropyl)-2,5-dimethylindole-6-carboxylic acid |
| SMILES | CCCCc1c(C)n(CCCO)c2cc(C(=O)O)c(C)cc12 |
| InChI | InChI=1S/C18H25NO3/c1-4-5-7-14-13(3)19(8-6-9-20)17-11-15(18(21)22)12(2)10-16(14)17/h10-11,20H,4-9H2,1-3H3,(H,21,22) |
| InChIKey | QFWXGTGZIRQZJE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|