C9H12FN3O2 — CID 83964832
3-(6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoic acid (PubChem CID 83964832) has the molecular formula C9H12FN3O2 and a molecular weight of 213.21 g/mol. Its IUPAC name is 3-(6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoic acid.
| Compound Name | 3-(6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoic acid |
|---|---|
| PubChem CID | 83964832 |
| Molecular Formula | C9H12FN3O2 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 3-(6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propanoic acid |
| SMILES | O=C(O)CCc1nc2n(n1)CC(F)CC2 |
| InChI | InChI=1S/C9H12FN3O2/c10-6-1-3-8-11-7(2-4-9(14)15)12-13(8)5-6/h6H,1-5H2,(H,14,15) |
| InChIKey | JLUJMFKGPUCWCG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |