About 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine
6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 83965118) has the molecular formula C12H8F2N4
and a molecular weight of 246.22 g/mol. Its IUPAC name is 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
Molecular Properties
| Compound Name | 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| PubChem CID | 83965118 |
| Molecular Formula | C12H8F2N4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | Nc1cc(F)cn2nc(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C12H8F2N4/c13-8-3-1-7(2-4-8)11-16-12-10(15)5-9(14)6-18(12)17-11/h1-6H,15H2 |
| InChIKey | LBTZAQZQYCVJRT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine?
The IUPAC name of 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine (CID 83965118) is 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
What is the SMILES notation for 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine?
The canonical SMILES for 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine is Nc1cc(F)cn2nc(-c3ccc(F)cc3)nc12.
What is the InChIKey of 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine?
The InChIKey is LBTZAQZQYCVJRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2N4/c13-8-3-1-7(2-4-8)11-16-12-10(15)5-9(14)6-18(12)17-11/h1-6H,15H2.
What are the key properties of 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine?
6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine has a molecular weight of 246.22 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine is sourced from PubChem (CID 83965118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).