C12H19FN4 — CID 83965564
2-cyclohexyl-6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 83965564) has the molecular formula C12H19FN4 and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-cyclohexyl-6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | 2-cyclohexyl-6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 83965564 |
| Molecular Formula | C12H19FN4 |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-cyclohexyl-6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | NC1CC(F)Cn2nc(C3CCCCC3)nc21 |
| InChI | InChI=1S/C12H19FN4/c13-9-6-10(14)12-15-11(16-17(12)7-9)8-4-2-1-3-5-8/h8-10H,1-7,14H2 |
| InChIKey | OMICIXVUTQYMAV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |