C10H15FN4 — CID 83965591
2-cyclobutyl-6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 83965591) has the molecular formula C10H15FN4 and a molecular weight of 210.26 g/mol. Its IUPAC name is 2-cyclobutyl-6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | 2-cyclobutyl-6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 83965591 |
| Molecular Formula | C10H15FN4 |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-cyclobutyl-6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | NC1CC(F)Cn2nc(C3CCC3)nc21 |
| InChI | InChI=1S/C10H15FN4/c11-7-4-8(12)10-13-9(6-2-1-3-6)14-15(10)5-7/h6-8H,1-5,12H2 |
| InChIKey | VZACBPAYQUWLTE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |