C14H9F2N3O — CID 83965863
2-(3,4-difluorophenyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde (PubChem CID 83965863) has the molecular formula C14H9F2N3O and a molecular weight of 273.24 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde.
| Compound Name | 2-(3,4-difluorophenyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 83965863 |
| Molecular Formula | C14H9F2N3O |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-(3,4-difluorophenyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridine-6-carbaldehyde |
| SMILES | Cc1cc2nc(-c3ccc(F)c(F)c3)nn2cc1C=O |
| InChI | InChI=1S/C14H9F2N3O/c1-8-4-13-17-14(18-19(13)6-10(8)7-20)9-2-3-11(15)12(16)5-9/h2-7H,1H3 |
| InChIKey | MORGGAZKKXRCDC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|