C13H14N2O — CID 83966113
4-methyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-2-carbaldehyde (PubChem CID 83966113) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 4-methyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-2-carbaldehyde.
| Compound Name | 4-methyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-2-carbaldehyde |
|---|---|
| PubChem CID | 83966113 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 4-methyl-6,7,8,9-tetrahydropyrido[1,2-a]benzimidazole-2-carbaldehyde |
| SMILES | Cc1cc(C=O)cn2c3c(nc12)CCCC3 |
| InChI | InChI=1S/C13H14N2O/c1-9-6-10(8-16)7-15-12-5-3-2-4-11(12)14-13(9)15/h6-8H,2-5H2,1H3 |
| InChIKey | MPUKKIITVBFLKY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|