C14H17FN4O — CID 83966816
2-ethoxy-5-(6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)aniline (PubChem CID 83966816) has the molecular formula C14H17FN4O and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-ethoxy-5-(6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)aniline.
| Compound Name | 2-ethoxy-5-(6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)aniline |
|---|---|
| PubChem CID | 83966816 |
| Molecular Formula | C14H17FN4O |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-ethoxy-5-(6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)aniline |
| SMILES | CCOc1ccc(-c2nc3n(n2)CC(F)CC3)cc1N |
| InChI | InChI=1S/C14H17FN4O/c1-2-20-12-5-3-9(7-11(12)16)14-17-13-6-4-10(15)8-19(13)18-14/h3,5,7,10H,2,4,6,8,16H2,1H3 |
| InChIKey | JYSQGXRGANHODJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|