About 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline
4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline (PubChem CID 83966881) has the molecular formula C13H12N4
and a molecular weight of 224.27 g/mol. Its IUPAC name is 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline.
Molecular Properties
| Compound Name | 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline |
| PubChem CID | 83966881 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline |
| SMILES | Nc1ccc(Cc2nc3ccccn3n2)cc1 |
| InChI | InChI=1S/C13H12N4/c14-11-6-4-10(5-7-11)9-12-15-13-3-1-2-8-17(13)16-12/h1-8H,9,14H2 |
| InChIKey | QSHJOPJKJYOAJD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline?
The IUPAC name of 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline (CID 83966881) is 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline.
What is the SMILES notation for 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline?
The canonical SMILES for 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline is Nc1ccc(Cc2nc3ccccn3n2)cc1.
What is the InChIKey of 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline?
The InChIKey is QSHJOPJKJYOAJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4/c14-11-6-4-10(5-7-11)9-12-15-13-3-1-2-8-17(13)16-12/h1-8H,9,14H2.
What are the key properties of 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline?
4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline has a molecular weight of 224.27 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-([1,2,4]triazolo[1,5-a]pyridin-2-ylmethyl)aniline is sourced from PubChem (CID 83966881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).