C13H11FN4 — CID 83967080
5-(8-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-2-methylaniline (PubChem CID 83967080) has the molecular formula C13H11FN4 and a molecular weight of 242.26 g/mol. Its IUPAC name is 5-(8-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-2-methylaniline.
| Compound Name | 5-(8-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-2-methylaniline |
|---|---|
| PubChem CID | 83967080 |
| Molecular Formula | C13H11FN4 |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 5-(8-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-2-methylaniline |
| SMILES | Cc1ccc(-c2nc3c(F)cccn3n2)cc1N |
| InChI | InChI=1S/C13H11FN4/c1-8-4-5-9(7-11(8)15)12-16-13-10(14)3-2-6-18(13)17-12/h2-7H,15H2,1H3 |
| InChIKey | HJYVMIPLHOZAOX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|