C15H17NO2S — CID 83967549
4-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propoxy]benzaldehyde (PubChem CID 83967549) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 4-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propoxy]benzaldehyde.
| Compound Name | 4-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propoxy]benzaldehyde |
|---|---|
| PubChem CID | 83967549 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 4-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propoxy]benzaldehyde |
| SMILES | Cc1nc(CCCOc2ccc(C=O)cc2)sc1C |
| InChI | InChI=1S/C15H17NO2S/c1-11-12(2)19-15(16-11)4-3-9-18-14-7-5-13(10-17)6-8-14/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | UMCROGJCROBNRY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|