C16H18N4O3 — CID 83967823
2-[[1-(3-amino-3-iminopropyl)-2-oxo-3-pyridinyl]oxy]-N-phenylacetamide (PubChem CID 83967823) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-[[1-(3-amino-3-iminopropyl)-2-oxo-3-pyridinyl]oxy]-N-phenylacetamide.
| Compound Name | 2-[[1-(3-amino-3-iminopropyl)-2-oxo-3-pyridinyl]oxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 83967823 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-[[1-(3-amino-3-iminopropyl)-2-oxo-3-pyridinyl]oxy]-N-phenylacetamide |
| SMILES | [H]/N=C(\N)CCn1cccc(OCC(=O)Nc2ccccc2)c1=O |
| InChI | InChI=1S/C16H18N4O3/c17-14(18)8-10-20-9-4-7-13(16(20)22)23-11-15(21)19-12-5-2-1-3-6-12/h1-7,9H,8,10-11H2,(H3,17,18)(H,19,21) |
| InChIKey | DXIRAMAYJOYBEP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|