C11H11ClFN3O — CID 83968033
3-(chloromethyl)-4-(4-fluorophenyl)-5-(methoxymethyl)-1,2,4-triazole (PubChem CID 83968033) has the molecular formula C11H11ClFN3O and a molecular weight of 255.68 g/mol. Its IUPAC name is 3-(chloromethyl)-4-(4-fluorophenyl)-5-(methoxymethyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-(4-fluorophenyl)-5-(methoxymethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 83968033 |
| Molecular Formula | C11H11ClFN3O |
| Molecular Weight | 255.68 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 3-(chloromethyl)-4-(4-fluorophenyl)-5-(methoxymethyl)-1,2,4-triazole |
| SMILES | COCc1nnc(CCl)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11ClFN3O/c1-17-7-11-15-14-10(6-12)16(11)9-4-2-8(13)3-5-9/h2-5H,6-7H2,1H3 |
| InChIKey | NUDPKUYAWUUNHL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.68 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|