About 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid
2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 83969601) has the molecular formula C15H17NO3S
and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 83969601 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | COc1c(C)cc(C)cc1Cc1nc(C)c(C(=O)O)s1 |
| InChI | InChI=1S/C15H17NO3S/c1-8-5-9(2)13(19-4)11(6-8)7-12-16-10(3)14(20-12)15(17)18/h5-6H,7H2,1-4H3,(H,17,18) |
| InChIKey | FVIODZRURMTCSC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CID 83969601) is 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid is COc1c(C)cc(C)cc1Cc1nc(C)c(C(=O)O)s1.
What is the InChIKey of 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is FVIODZRURMTCSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3S/c1-8-5-9(2)13(19-4)11(6-8)7-12-16-10(3)14(20-12)15(17)18/h5-6H,7H2,1-4H3,(H,17,18).
What are the key properties of 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid?
2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 291.37 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methoxy-3,5-dimethylphenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 83969601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).