About 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid
2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid (PubChem CID 83970052) has the molecular formula C16H16N2O2S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
| PubChem CID | 83970052 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
| SMILES | CCc1ccc(Cc2sc3nc(C(=O)O)cn3c2C)cc1 |
| InChI | InChI=1S/C16H16N2O2S/c1-3-11-4-6-12(7-5-11)8-14-10(2)18-9-13(15(19)20)17-16(18)21-14/h4-7,9H,3,8H2,1-2H3,(H,19,20) |
| InChIKey | QUBQWSRCTOBMDT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The IUPAC name of 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid (CID 83970052) is 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid.
What is the SMILES notation for 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The canonical SMILES for 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid is CCc1ccc(Cc2sc3nc(C(=O)O)cn3c2C)cc1.
What is the InChIKey of 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The InChIKey is QUBQWSRCTOBMDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S/c1-3-11-4-6-12(7-5-11)8-14-10(2)18-9-13(15(19)20)17-16(18)21-14/h4-7,9H,3,8H2,1-2H3,(H,19,20).
What are the key properties of 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid has a molecular weight of 300.38 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-ethylphenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid is sourced from PubChem (CID 83970052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).