C16H21N3S — CID 83970171
[4-methyl-5-[(4-pyrrolidin-1-ylphenyl)methyl]-1,3-thiazol-2-yl]methanamine (PubChem CID 83970171) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is [4-methyl-5-[(4-pyrrolidin-1-ylphenyl)methyl]-1,3-thiazol-2-yl]methanamine.
| Compound Name | [4-methyl-5-[(4-pyrrolidin-1-ylphenyl)methyl]-1,3-thiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 83970171 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | [4-methyl-5-[(4-pyrrolidin-1-ylphenyl)methyl]-1,3-thiazol-2-yl]methanamine |
| SMILES | Cc1nc(CN)sc1Cc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C16H21N3S/c1-12-15(20-16(11-17)18-12)10-13-4-6-14(7-5-13)19-8-2-3-9-19/h4-7H,2-3,8-11,17H2,1H3 |
| InChIKey | WCBKVAMVDVKKSZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|