C13H13N3 — CID 83970826
1-pyridin-3-yl-1,2,3,4-tetrahydro-2,7-naphthyridine (PubChem CID 83970826) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 1-pyridin-3-yl-1,2,3,4-tetrahydro-2,7-naphthyridine.
| Compound Name | 1-pyridin-3-yl-1,2,3,4-tetrahydro-2,7-naphthyridine |
|---|---|
| PubChem CID | 83970826 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-pyridin-3-yl-1,2,3,4-tetrahydro-2,7-naphthyridine |
| SMILES | c1cncc(C2NCCc3ccncc32)c1 |
| InChI | InChI=1S/C13H13N3/c1-2-11(8-14-5-1)13-12-9-15-6-3-10(12)4-7-16-13/h1-3,5-6,8-9,13,16H,4,7H2 |
| InChIKey | RQLNNSNSKJBCSN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |