C20H27NO3 — CID 83972590
3-(3,4-diethoxyphenyl)-2-(3-methoxyphenyl)propan-1-amine (PubChem CID 83972590) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-2-(3-methoxyphenyl)propan-1-amine.
| Compound Name | 3-(3,4-diethoxyphenyl)-2-(3-methoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83972590 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-2-(3-methoxyphenyl)propan-1-amine |
| SMILES | CCOc1ccc(CC(CN)c2cccc(OC)c2)cc1OCC |
| InChI | InChI=1S/C20H27NO3/c1-4-23-19-10-9-15(12-20(19)24-5-2)11-17(14-21)16-7-6-8-18(13-16)22-3/h6-10,12-13,17H,4-5,11,14,21H2,1-3H3 |
| InChIKey | IORBMXDNJXPJSR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |