C21H19F2NO — CID 83973683
2-(3,4-difluorophenyl)-3-(3-phenoxyphenyl)propan-1-amine (PubChem CID 83973683) has the molecular formula C21H19F2NO and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-3-(3-phenoxyphenyl)propan-1-amine.
| Compound Name | 2-(3,4-difluorophenyl)-3-(3-phenoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83973683 |
| Molecular Formula | C21H19F2NO |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-(3,4-difluorophenyl)-3-(3-phenoxyphenyl)propan-1-amine |
| SMILES | NCC(Cc1cccc(Oc2ccccc2)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H19F2NO/c22-20-10-9-16(13-21(20)23)17(14-24)11-15-5-4-8-19(12-15)25-18-6-2-1-3-7-18/h1-10,12-13,17H,11,14,24H2 |
| InChIKey | NCDBBUUDBHVWKQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |