C16H18Cl2N2O — CID 83975851
3-(3,5-dichloro-4-ethoxyphenyl)-2-pyridin-2-ylpropan-1-amine (PubChem CID 83975851) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-ethoxyphenyl)-2-pyridin-2-ylpropan-1-amine.
| Compound Name | 3-(3,5-dichloro-4-ethoxyphenyl)-2-pyridin-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 83975851 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 3-(3,5-dichloro-4-ethoxyphenyl)-2-pyridin-2-ylpropan-1-amine |
| SMILES | CCOc1c(Cl)cc(CC(CN)c2ccccn2)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O/c1-2-21-16-13(17)8-11(9-14(16)18)7-12(10-19)15-5-3-4-6-20-15/h3-6,8-9,12H,2,7,10,19H2,1H3 |
| InChIKey | ABAMKBXWNXHZTN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |