C15H20Cl2N2O2 — CID 83977841
2-(2,6-dichlorophenyl)-2-(3-ethyl-4-methylpiperazin-1-yl)acetic acid (PubChem CID 83977841) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-2-(3-ethyl-4-methylpiperazin-1-yl)acetic acid.
| Compound Name | 2-(2,6-dichlorophenyl)-2-(3-ethyl-4-methylpiperazin-1-yl)acetic acid |
|---|---|
| PubChem CID | 83977841 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-2-(3-ethyl-4-methylpiperazin-1-yl)acetic acid |
| SMILES | CCC1CN(C(C(=O)O)c2c(Cl)cccc2Cl)CCN1C |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-3-10-9-19(8-7-18(10)2)14(15(20)21)13-11(16)5-4-6-12(13)17/h4-6,10,14H,3,7-9H2,1-2H3,(H,20,21) |
| InChIKey | CNAOKVJGROOZHN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |