C20H33N3O — CID 83978094
1-[1-(3-methoxyphenyl)-2-(3-methylpiperidin-1-yl)ethyl]-2-methylpiperazine (PubChem CID 83978094) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is 1-[1-(3-methoxyphenyl)-2-(3-methylpiperidin-1-yl)ethyl]-2-methylpiperazine.
| Compound Name | 1-[1-(3-methoxyphenyl)-2-(3-methylpiperidin-1-yl)ethyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 83978094 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | 1-[1-(3-methoxyphenyl)-2-(3-methylpiperidin-1-yl)ethyl]-2-methylpiperazine |
| SMILES | COc1cccc(C(CN2CCCC(C)C2)N2CCNCC2C)c1 |
| InChI | InChI=1S/C20H33N3O/c1-16-6-5-10-22(14-16)15-20(23-11-9-21-13-17(23)2)18-7-4-8-19(12-18)24-3/h4,7-8,12,16-17,20-21H,5-6,9-11,13-15H2,1-3H3 |
| InChIKey | XOLBPLYXIXASGW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |