About 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine
2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine (PubChem CID 83978630) has the molecular formula C19H33N3
and a molecular weight of 303.49 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine |
| PubChem CID | 83978630 |
| Molecular Formula | C19H33N3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.27 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine |
| SMILES | CC1CN(C(CN(C)C)c2ccc(C(C)(C)C)cc2)CCN1 |
| InChI | InChI=1S/C19H33N3/c1-15-13-22(12-11-20-15)18(14-21(5)6)16-7-9-17(10-8-16)19(2,3)4/h7-10,15,18,20H,11-14H2,1-6H3 |
| InChIKey | JLTOYRWFKBQYNK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine?
The IUPAC name of 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine (CID 83978630) is 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine.
What is the SMILES notation for 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine?
The canonical SMILES for 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine is CC1CN(C(CN(C)C)c2ccc(C(C)(C)C)cc2)CCN1.
What is the InChIKey of 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine?
The InChIKey is JLTOYRWFKBQYNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33N3/c1-15-13-22(12-11-20-15)18(14-21(5)6)16-7-9-17(10-8-16)19(2,3)4/h7-10,15,18,20H,11-14H2,1-6H3.
What are the key properties of 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine?
2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine has a molecular weight of 303.49 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylphenyl)-N,N-dimethyl-2-(3-methylpiperazin-1-yl)ethanamine is sourced from PubChem (CID 83978630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).