About 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol
2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol (PubChem CID 83980539) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol |
| PubChem CID | 83980539 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol |
| SMILES | Cc1cc2c(cc1C)C1(CCNCC1)CN2CCO |
| InChI | InChI=1S/C16H24N2O/c1-12-9-14-15(10-13(12)2)18(7-8-19)11-16(14)3-5-17-6-4-16/h9-10,17,19H,3-8,11H2,1-2H3 |
| InChIKey | GALIINJXFLGHGV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol?
The IUPAC name of 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol (CID 83980539) is 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol.
What is the SMILES notation for 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol?
The canonical SMILES for 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol is Cc1cc2c(cc1C)C1(CCNCC1)CN2CCO.
What is the InChIKey of 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol?
The InChIKey is GALIINJXFLGHGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O/c1-12-9-14-15(10-13(12)2)18(7-8-19)11-16(14)3-5-17-6-4-16/h9-10,17,19H,3-8,11H2,1-2H3.
What are the key properties of 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol?
2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol has a molecular weight of 260.38 g/mol, XLogP of 1.74, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dimethylspiro[2H-indole-3,4'-piperidine]-1-yl)ethanol is sourced from PubChem (CID 83980539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).