About 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine]
1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine] (PubChem CID 83980562) has the molecular formula C16H24N2O2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine].
Molecular Properties
| Compound Name | 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine] |
| PubChem CID | 83980562 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine] |
| SMILES | CCN1CC2(CCNCC2)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C16H24N2O2/c1-4-18-11-16(5-7-17-8-6-16)12-9-14(19-2)15(20-3)10-13(12)18/h9-10,17H,4-8,11H2,1-3H3 |
| InChIKey | TZGKZMPVAGFMDD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine]?
The IUPAC name of 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine] (CID 83980562) is 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine].
What is the SMILES notation for 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine]?
The canonical SMILES for 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine] is CCN1CC2(CCNCC2)c2cc(OC)c(OC)cc21.
What is the InChIKey of 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine]?
The InChIKey is TZGKZMPVAGFMDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-4-18-11-16(5-7-17-8-6-16)12-9-14(19-2)15(20-3)10-13(12)18/h9-10,17H,4-8,11H2,1-3H3.
What are the key properties of 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine]?
1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine] has a molecular weight of 276.38 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5,6-dimethoxyspiro[2H-indole-3,4'-piperidine] is sourced from PubChem (CID 83980562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).