C16H23F3N2O — CID 83981186
1-[1-(4-methoxyphenyl)pyrrolidin-3-yl]-N-(2,2,2-trifluoroethyl)propan-2-amine (PubChem CID 83981186) has the molecular formula C16H23F3N2O and a molecular weight of 316.37 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)pyrrolidin-3-yl]-N-(2,2,2-trifluoroethyl)propan-2-amine.
| Compound Name | 1-[1-(4-methoxyphenyl)pyrrolidin-3-yl]-N-(2,2,2-trifluoroethyl)propan-2-amine |
|---|---|
| PubChem CID | 83981186 |
| Molecular Formula | C16H23F3N2O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)pyrrolidin-3-yl]-N-(2,2,2-trifluoroethyl)propan-2-amine |
| SMILES | COc1ccc(N2CCC(CC(C)NCC(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C16H23F3N2O/c1-12(20-11-16(17,18)19)9-13-7-8-21(10-13)14-3-5-15(22-2)6-4-14/h3-6,12-13,20H,7-11H2,1-2H3 |
| InChIKey | BIXYCBZJNJBGIH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|