C14H21ClN2 — CID 83981425
1-[1-(4-chlorophenyl)pyrrolidin-3-yl]butan-2-amine (PubChem CID 83981425) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)pyrrolidin-3-yl]butan-2-amine.
| Compound Name | 1-[1-(4-chlorophenyl)pyrrolidin-3-yl]butan-2-amine |
|---|---|
| PubChem CID | 83981425 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-[1-(4-chlorophenyl)pyrrolidin-3-yl]butan-2-amine |
| SMILES | CCC(N)CC1CCN(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C14H21ClN2/c1-2-13(16)9-11-7-8-17(10-11)14-5-3-12(15)4-6-14/h3-6,11,13H,2,7-10,16H2,1H3 |
| InChIKey | PVLZUARDYGVWQZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |