C17H25NO3 — CID 83982051
2-[[1-(4-ethoxyphenyl)pyrrolidin-3-yl]methyl]butanoic acid (PubChem CID 83982051) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[[1-(4-ethoxyphenyl)pyrrolidin-3-yl]methyl]butanoic acid.
| Compound Name | 2-[[1-(4-ethoxyphenyl)pyrrolidin-3-yl]methyl]butanoic acid |
|---|---|
| PubChem CID | 83982051 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-[[1-(4-ethoxyphenyl)pyrrolidin-3-yl]methyl]butanoic acid |
| SMILES | CCOc1ccc(N2CCC(CC(CC)C(=O)O)C2)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-3-14(17(19)20)11-13-9-10-18(12-13)15-5-7-16(8-6-15)21-4-2/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,19,20) |
| InChIKey | LBKCXIKUMIDMSE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|