C20H32N2 — CID 83982714
1-cyclopentyl-2-[1-[(4-methylphenyl)methyl]piperidin-3-yl]ethanamine (PubChem CID 83982714) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 1-cyclopentyl-2-[1-[(4-methylphenyl)methyl]piperidin-3-yl]ethanamine.
| Compound Name | 1-cyclopentyl-2-[1-[(4-methylphenyl)methyl]piperidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 83982714 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | 1-cyclopentyl-2-[1-[(4-methylphenyl)methyl]piperidin-3-yl]ethanamine |
| SMILES | Cc1ccc(CN2CCCC(CC(N)C3CCCC3)C2)cc1 |
| InChI | InChI=1S/C20H32N2/c1-16-8-10-17(11-9-16)14-22-12-4-5-18(15-22)13-20(21)19-6-2-3-7-19/h8-11,18-20H,2-7,12-15,21H2,1H3 |
| InChIKey | WXAWRQZYOWLQKP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |