C17H28N2 — CID 83983420
1-[1-[(3-methylphenyl)methyl]piperidin-4-yl]butan-2-amine (PubChem CID 83983420) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 1-[1-[(3-methylphenyl)methyl]piperidin-4-yl]butan-2-amine.
| Compound Name | 1-[1-[(3-methylphenyl)methyl]piperidin-4-yl]butan-2-amine |
|---|---|
| PubChem CID | 83983420 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 1-[1-[(3-methylphenyl)methyl]piperidin-4-yl]butan-2-amine |
| SMILES | CCC(N)CC1CCN(Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C17H28N2/c1-3-17(18)12-15-7-9-19(10-8-15)13-16-6-4-5-14(2)11-16/h4-6,11,15,17H,3,7-10,12-13,18H2,1-2H3 |
| InChIKey | RLHZGARTDSERHR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |